C28H34N2O4 — CID 11532754
(1R,3aR)-6-ethyl-N-(2-hydroxyethyl)-1,5-dimethyl-3-oxo-7-[(E)-2-(5-phenyl-2-pyridinyl)ethenyl]-1,4,5,6,7,7a-hexahydro-2-benzofuran-3a-carboxamide (PubChem CID 11532754) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is (1R,3aR)-6-ethyl-N-(2-hydroxyethyl)-1,5-dimethyl-3-oxo-7-[(E)-2-(5-phenyl-2-pyridinyl)ethenyl]-1,4,5,6,7,7a-hexahydro-2-benzofuran-3a-carboxamide.
| Compound Name | (1R,3aR)-6-ethyl-N-(2-hydroxyethyl)-1,5-dimethyl-3-oxo-7-[(E)-2-(5-phenyl-2-pyridinyl)ethenyl]-1,4,5,6,7,7a-hexahydro-2-benzofuran-3a-carboxamide |
|---|---|
| PubChem CID | 11532754 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (1R,3aR)-6-ethyl-N-(2-hydroxyethyl)-1,5-dimethyl-3-oxo-7-[(E)-2-(5-phenyl-2-pyridinyl)ethenyl]-1,4,5,6,7,7a-hexahydro-2-benzofuran-3a-carboxamide |
| SMILES | CCC1C(C)C[C@@]2(C(=O)NCCO)C(=O)OC(C)C2C1/C=C/c1ccc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C28H34N2O4/c1-4-23-18(2)16-28(26(32)29-14-15-31)25(19(3)34-27(28)33)24(23)13-12-22-11-10-21(17-30-22)20-8-6-5-7-9-20/h5-13,17-19,23-25,31H,4,14-16H2,1-3H3,(H,29,32)/b13-12+/t18?,19?,23?,24?,25?,28-/m1/s1 |
| InChIKey | AWTITGWPJQAFAA-BGZMRHJMSA-N |
| XLogP | 4.10 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|