C18H26F6N2O5 — CID 11532776
tert-butyl (3R)-3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]-5-methylhexanoate (PubChem CID 11532776) has the molecular formula C18H26F6N2O5 and a molecular weight of 464.40 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]-5-methylhexanoate.
| Compound Name | tert-butyl (3R)-3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]-5-methylhexanoate |
|---|---|
| PubChem CID | 11532776 |
| Molecular Formula | C18H26F6N2O5 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | tert-butyl (3R)-3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]-5-methylhexanoate |
| SMILES | CC(C)C[C@H](CC(=O)OC(C)(C)C)NC(=O)C1=NOC(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C18H26F6N2O5/c1-9(2)6-10(7-13(27)30-15(3,4)5)25-14(28)11-8-12(31-26-11)16(29,17(19,20)21)18(22,23)24/h9-10,12,29H,6-8H2,1-5H3,(H,25,28)/t10-,12?/m1/s1 |
| InChIKey | DDFGGFJZDBWIBY-RWANSRKNSA-N |
| XLogP | 3.25 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |