C24H27N5O3S — CID 11532808
11-(3,4-dimethoxyphenyl)-4-ethoxy-13-methyl-6-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 11532808) has the molecular formula C24H27N5O3S and a molecular weight of 465.58 g/mol. Its IUPAC name is 11-(3,4-dimethoxyphenyl)-4-ethoxy-13-methyl-6-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-(3,4-dimethoxyphenyl)-4-ethoxy-13-methyl-6-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 11532808 |
| Molecular Formula | C24H27N5O3S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 11-(3,4-dimethoxyphenyl)-4-ethoxy-13-methyl-6-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CCOc1nc(N2CCNCC2)c2sc3nc(-c4ccc(OC)c(OC)c4)cc(C)c3c2n1 |
| InChI | InChI=1S/C24H27N5O3S/c1-5-32-24-27-20-19-14(2)12-16(15-6-7-17(30-3)18(13-15)31-4)26-23(19)33-21(20)22(28-24)29-10-8-25-9-11-29/h6-7,12-13,25H,5,8-11H2,1-4H3 |
| InChIKey | UPHSZMJBQVQXRB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |