C15H22N2 — CID 115328538
N-methyl-1-[1-(2-phenylprop-2-enyl)pyrrolidin-2-yl]methanamine (PubChem CID 115328538) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is N-methyl-1-[1-(2-phenylprop-2-enyl)pyrrolidin-2-yl]methanamine.
| Compound Name | N-methyl-1-[1-(2-phenylprop-2-enyl)pyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 115328538 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N-methyl-1-[1-(2-phenylprop-2-enyl)pyrrolidin-2-yl]methanamine |
| SMILES | C=C(CN1CCCC1CNC)c1ccccc1 |
| InChI | InChI=1S/C15H22N2/c1-13(14-7-4-3-5-8-14)12-17-10-6-9-15(17)11-16-2/h3-5,7-8,15-16H,1,6,9-12H2,2H3 |
| InChIKey | SRGKRLZEGIFIMC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |