C24H22F2N4O4 — CID 11532865
methyl 2-fluoro-6-[3-fluoro-4-[[4-(pyrimidine-5-carbonylamino)butanoylamino]methyl]phenyl]benzoate (PubChem CID 11532865) has the molecular formula C24H22F2N4O4 and a molecular weight of 468.46 g/mol. Its IUPAC name is methyl 2-fluoro-6-[3-fluoro-4-[[4-(pyrimidine-5-carbonylamino)butanoylamino]methyl]phenyl]benzoate.
| Compound Name | methyl 2-fluoro-6-[3-fluoro-4-[[4-(pyrimidine-5-carbonylamino)butanoylamino]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 11532865 |
| Molecular Formula | C24H22F2N4O4 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | methyl 2-fluoro-6-[3-fluoro-4-[[4-(pyrimidine-5-carbonylamino)butanoylamino]methyl]phenyl]benzoate |
| SMILES | COC(=O)c1c(F)cccc1-c1ccc(CNC(=O)CCCNC(=O)c2cncnc2)c(F)c1 |
| InChI | InChI=1S/C24H22F2N4O4/c1-34-24(33)22-18(4-2-5-19(22)25)15-7-8-16(20(26)10-15)13-30-21(31)6-3-9-29-23(32)17-11-27-14-28-12-17/h2,4-5,7-8,10-12,14H,3,6,9,13H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | UAUWSWZUXLCJPC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|