C8H13N3OS — CID 115331085
2-(ethoxymethylsulfanyl)-6-methylpyrimidin-4-amine (PubChem CID 115331085) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-(ethoxymethylsulfanyl)-6-methylpyrimidin-4-amine.
| Compound Name | 2-(ethoxymethylsulfanyl)-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115331085 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-(ethoxymethylsulfanyl)-6-methylpyrimidin-4-amine |
| SMILES | CCOCSc1nc(C)cc(N)n1 |
| InChI | InChI=1S/C8H13N3OS/c1-3-12-5-13-8-10-6(2)4-7(9)11-8/h4H,3,5H2,1-2H3,(H2,9,10,11) |
| InChIKey | NMPMKAMWBUCADK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|