C11H14N4OS2 — CID 115331860
4-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)morpholine-2-carbothioamide (PubChem CID 115331860) has the molecular formula C11H14N4OS2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 4-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)morpholine-2-carbothioamide.
| Compound Name | 4-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)morpholine-2-carbothioamide |
|---|---|
| PubChem CID | 115331860 |
| Molecular Formula | C11H14N4OS2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 4-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)morpholine-2-carbothioamide |
| SMILES | NC(=S)C1CN(Cc2cn3ccsc3n2)CCO1 |
| InChI | InChI=1S/C11H14N4OS2/c12-10(17)9-7-14(1-3-16-9)5-8-6-15-2-4-18-11(15)13-8/h2,4,6,9H,1,3,5,7H2,(H2,12,17) |
| InChIKey | VETYHVJANGFAHN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|