C16H16N2O2S — CID 115332527
2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-phenylbutanoic acid (PubChem CID 115332527) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-phenylbutanoic acid.
| Compound Name | 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 115332527 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-phenylbutanoic acid |
| SMILES | CCC(Cc1cn2ccsc2n1)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O2S/c1-2-16(14(19)20,12-6-4-3-5-7-12)10-13-11-18-8-9-21-15(18)17-13/h3-9,11H,2,10H2,1H3,(H,19,20) |
| InChIKey | YZUOKIWSIFBPES-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |