C25H54O5Si2 — CID 11533270
(2R,3S)-4-(methoxymethoxy)-3-methyl-2,3-bis[tri(propan-2-yl)silyloxy]butanal (PubChem CID 11533270) has the molecular formula C25H54O5Si2 and a molecular weight of 490.87 g/mol. Its IUPAC name is (2R,3S)-4-(methoxymethoxy)-3-methyl-2,3-bis[tri(propan-2-yl)silyloxy]butanal.
| Compound Name | (2R,3S)-4-(methoxymethoxy)-3-methyl-2,3-bis[tri(propan-2-yl)silyloxy]butanal |
|---|---|
| PubChem CID | 11533270 |
| Molecular Formula | C25H54O5Si2 |
| Molecular Weight | 490.87 g/mol |
| Exact Mass | 490.35 |
| IUPAC Name | (2R,3S)-4-(methoxymethoxy)-3-methyl-2,3-bis[tri(propan-2-yl)silyloxy]butanal |
| SMILES | COCOC[C@](C)(O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H54O5Si2/c1-18(2)31(19(3)4,20(5)6)29-24(15-26)25(13,16-28-17-27-14)30-32(21(7)8,22(9)10)23(11)12/h15,18-24H,16-17H2,1-14H3/t24-,25-/m0/s1 |
| InChIKey | XMTCNAGAEKVVLJ-DQEYMECFSA-N |
| XLogP | 7.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.87 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|