C15H23N3S — CID 115335393
N-[[2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)cyclopentyl]methyl]propan-1-amine (PubChem CID 115335393) has the molecular formula C15H23N3S and a molecular weight of 277.44 g/mol. Its IUPAC name is N-[[2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)cyclopentyl]methyl]propan-1-amine.
| Compound Name | N-[[2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)cyclopentyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 115335393 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N-[[2-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)cyclopentyl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCCC1Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C15H23N3S/c1-2-6-16-10-13-5-3-4-12(13)9-14-11-18-7-8-19-15(18)17-14/h7-8,11-13,16H,2-6,9-10H2,1H3 |
| InChIKey | WLHHIFLLIZNNCQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|