C34H36O4 — CID 11533552
2-[6-[3-(1-adamantyl)-4-(2,3-dihydroxypropyl)phenyl]naphthalen-2-yl]cyclopentane-1,3-dione (PubChem CID 11533552) has the molecular formula C34H36O4 and a molecular weight of 508.66 g/mol. Its IUPAC name is 2-[6-[3-(1-adamantyl)-4-(2,3-dihydroxypropyl)phenyl]naphthalen-2-yl]cyclopentane-1,3-dione.
| Compound Name | 2-[6-[3-(1-adamantyl)-4-(2,3-dihydroxypropyl)phenyl]naphthalen-2-yl]cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 11533552 |
| Molecular Formula | C34H36O4 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 2-[6-[3-(1-adamantyl)-4-(2,3-dihydroxypropyl)phenyl]naphthalen-2-yl]cyclopentane-1,3-dione |
| SMILES | O=C1CCC(=O)C1c1ccc2cc(-c3ccc(CC(O)CO)c(C45CC6CC(CC(C6)C4)C5)c3)ccc2c1 |
| InChI | InChI=1S/C34H36O4/c35-19-29(36)14-27-5-3-26(15-30(27)34-16-20-9-21(17-34)11-22(10-20)18-34)24-1-2-25-13-28(6-4-23(25)12-24)33-31(37)7-8-32(33)38/h1-6,12-13,15,20-22,29,33,35-36H,7-11,14,16-19H2 |
| InChIKey | DCSIAJMWUVNROT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|