C16H19Cl3F3N5O4 — CID 11533554
(1,1,1-trichloro-2-methylpropan-2-yl) N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 11533554) has the molecular formula C16H19Cl3F3N5O4 and a molecular weight of 508.71 g/mol. Its IUPAC name is (1,1,1-trichloro-2-methylpropan-2-yl) N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | (1,1,1-trichloro-2-methylpropan-2-yl) N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11533554 |
| Molecular Formula | C16H19Cl3F3N5O4 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | (1,1,1-trichloro-2-methylpropan-2-yl) N-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)CN(NC(=O)OC(C)(C)C(Cl)(Cl)Cl)c1ccnc(C#N)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H18Cl3N5O2.C2HF3O2/c1-9(2)8-22(11-5-6-19-10(7-18)20-11)21-12(23)24-13(3,4)14(15,16)17;3-2(4,5)1(6)7/h5-6,9H,8H2,1-4H3,(H,21,23);(H,6,7) |
| InChIKey | NINYKHKYBHHIPE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|