C13H15N3O4S — CID 115335954
2-[[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]methoxy]aniline (PubChem CID 115335954) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-[[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]methoxy]aniline.
| Compound Name | 2-[[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]methoxy]aniline |
|---|---|
| PubChem CID | 115335954 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-[[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]methoxy]aniline |
| SMILES | Nc1ccccc1OCc1nc(C2CCS(=O)(=O)C2)no1 |
| InChI | InChI=1S/C13H15N3O4S/c14-10-3-1-2-4-11(10)19-7-12-15-13(16-20-12)9-5-6-21(17,18)8-9/h1-4,9H,5-8,14H2 |
| InChIKey | RDQRRBMRFYDTFQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|