C26H27F3O6S — CID 11533774
[(6S,8S,9R,10S,11R,13S,14S,17R)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate (PubChem CID 11533774) has the molecular formula C26H27F3O6S and a molecular weight of 524.56 g/mol. Its IUPAC name is [(6S,8S,9R,10S,11R,13S,14S,17R)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate.
| Compound Name | [(6S,8S,9R,10S,11R,13S,14S,17R)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 11533774 |
| Molecular Formula | C26H27F3O6S |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | [(6S,8S,9R,10S,11R,13S,14S,17R)-6,9-difluoro-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
| SMILES | C[C@]12C=CC(=O)C=C1[C@@H](F)C[C@H]1[C@@H]3CC[C@](OC(=O)c4ccco4)(C(=O)SCF)[C@@]3(C)C[C@@H](O)[C@@]12F |
| InChI | InChI=1S/C26H27F3O6S/c1-23-7-5-14(30)10-17(23)18(28)11-16-15-6-8-25(22(33)36-13-27,35-21(32)19-4-3-9-34-19)24(15,2)12-20(31)26(16,23)29/h3-5,7,9-10,15-16,18,20,31H,6,8,11-13H2,1-2H3/t15-,16-,18-,20+,23-,24-,25-,26-/m0/s1 |
| InChIKey | ABMFVWTYDQTYFZ-ZQWUVMEDSA-N |
| XLogP | 4.68 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|