About [1,1-dioxo-3-(1,3-thiazol-2-ylmethyl)thiolan-3-yl]methanamine
[1,1-dioxo-3-(1,3-thiazol-2-ylmethyl)thiolan-3-yl]methanamine (PubChem CID 115337842) has the molecular formula C9H14N2O2S2
and a molecular weight of 246.36 g/mol. Its IUPAC name is [1,1-dioxo-3-(1,3-thiazol-2-ylmethyl)thiolan-3-yl]methanamine.
Molecular Properties
| Compound Name | [1,1-dioxo-3-(1,3-thiazol-2-ylmethyl)thiolan-3-yl]methanamine |
| PubChem CID | 115337842 |
| Molecular Formula | C9H14N2O2S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | [1,1-dioxo-3-(1,3-thiazol-2-ylmethyl)thiolan-3-yl]methanamine |
| SMILES | NCC1(Cc2nccs2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H14N2O2S2/c10-6-9(1-4-15(12,13)7-9)5-8-11-2-3-14-8/h2-3H,1,4-7,10H2 |
| InChIKey | UYDYZGBBIJBUSU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1,1-dioxo-3-(1,3-thiazol-2-ylmethyl)thiolan-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1-dioxo-3-(1,3-thiazol-2-ylmethyl)thiolan-3-yl]methanamine?
The IUPAC name of [1,1-dioxo-3-(1,3-thiazol-2-ylmethyl)thiolan-3-yl]methanamine (CID 115337842) is [1,1-dioxo-3-(1,3-thiazol-2-ylmethyl)thiolan-3-yl]methanamine.
What is the SMILES notation for [1,1-dioxo-3-(1,3-thiazol-2-ylmethyl)thiolan-3-yl]methanamine?
The canonical SMILES for [1,1-dioxo-3-(1,3-thiazol-2-ylmethyl)thiolan-3-yl]methanamine is NCC1(Cc2nccs2)CCS(=O)(=O)C1.
What is the InChIKey of [1,1-dioxo-3-(1,3-thiazol-2-ylmethyl)thiolan-3-yl]methanamine?
The InChIKey is UYDYZGBBIJBUSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S2/c10-6-9(1-4-15(12,13)7-9)5-8-11-2-3-14-8/h2-3H,1,4-7,10H2.
What are the key properties of [1,1-dioxo-3-(1,3-thiazol-2-ylmethyl)thiolan-3-yl]methanamine?
[1,1-dioxo-3-(1,3-thiazol-2-ylmethyl)thiolan-3-yl]methanamine has a molecular weight of 246.36 g/mol, XLogP of 0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1-dioxo-3-(1,3-thiazol-2-ylmethyl)thiolan-3-yl]methanamine is sourced from PubChem (CID 115337842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).