About 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-1-(4-bromophenyl)ethanol
1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-1-(4-bromophenyl)ethanol (PubChem CID 115338428) has the molecular formula C13H18BrNO3S
and a molecular weight of 348.26 g/mol. Its IUPAC name is 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-1-(4-bromophenyl)ethanol.
Molecular Properties
| Compound Name | 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-1-(4-bromophenyl)ethanol |
| PubChem CID | 115338428 |
| Molecular Formula | C13H18BrNO3S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-1-(4-bromophenyl)ethanol |
| SMILES | CC(O)(c1ccc(Br)cc1)C1(CN)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18BrNO3S/c1-12(16,10-2-4-11(14)5-3-10)13(8-15)6-7-19(17,18)9-13/h2-5,16H,6-9,15H2,1H3 |
| InChIKey | AKFHVHRPLWQEOK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-1-(4-bromophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-1-(4-bromophenyl)ethanol?
The IUPAC name of 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-1-(4-bromophenyl)ethanol (CID 115338428) is 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-1-(4-bromophenyl)ethanol.
What is the SMILES notation for 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-1-(4-bromophenyl)ethanol?
The canonical SMILES for 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-1-(4-bromophenyl)ethanol is CC(O)(c1ccc(Br)cc1)C1(CN)CCS(=O)(=O)C1.
What is the InChIKey of 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-1-(4-bromophenyl)ethanol?
The InChIKey is AKFHVHRPLWQEOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BrNO3S/c1-12(16,10-2-4-11(14)5-3-10)13(8-15)6-7-19(17,18)9-13/h2-5,16H,6-9,15H2,1H3.
What are the key properties of 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-1-(4-bromophenyl)ethanol?
1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-1-(4-bromophenyl)ethanol has a molecular weight of 348.26 g/mol, XLogP of 1.42, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-1-(4-bromophenyl)ethanol is sourced from PubChem (CID 115338428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).