C27H25FN4O3S2 — CID 11533908
N,N-diethyl-7-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]thieno[3,2-b]pyridine-2-carboxamide (PubChem CID 11533908) has the molecular formula C27H25FN4O3S2 and a molecular weight of 536.65 g/mol. Its IUPAC name is N,N-diethyl-7-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]thieno[3,2-b]pyridine-2-carboxamide.
| Compound Name | N,N-diethyl-7-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]thieno[3,2-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 11533908 |
| Molecular Formula | C27H25FN4O3S2 |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | N,N-diethyl-7-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]thieno[3,2-b]pyridine-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc2nccc(Oc3ccc(NC(=S)NC(=O)Cc4ccccc4)cc3F)c2s1 |
| InChI | InChI=1S/C27H25FN4O3S2/c1-3-32(4-2)26(34)23-16-20-25(37-23)22(12-13-29-20)35-21-11-10-18(15-19(21)28)30-27(36)31-24(33)14-17-8-6-5-7-9-17/h5-13,15-16H,3-4,14H2,1-2H3,(H2,30,31,33,36) |
| InChIKey | NXEYJEPOEMMBPI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|