C32H35N3O3S — CID 11533976
2-cyclopent-2-en-1-yl-N-[(4-methylsulfonylphenyl)methyl]-6-(3-phenylpyrrolo[2,3-b]pyridin-1-yl)hexanamide (PubChem CID 11533976) has the molecular formula C32H35N3O3S and a molecular weight of 541.72 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-[(4-methylsulfonylphenyl)methyl]-6-(3-phenylpyrrolo[2,3-b]pyridin-1-yl)hexanamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-[(4-methylsulfonylphenyl)methyl]-6-(3-phenylpyrrolo[2,3-b]pyridin-1-yl)hexanamide |
|---|---|
| PubChem CID | 11533976 |
| Molecular Formula | C32H35N3O3S |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-[(4-methylsulfonylphenyl)methyl]-6-(3-phenylpyrrolo[2,3-b]pyridin-1-yl)hexanamide |
| SMILES | CS(=O)(=O)c1ccc(CNC(=O)C(CCCCn2cc(-c3ccccc3)c3cccnc32)C2C=CCC2)cc1 |
| InChI | InChI=1S/C32H35N3O3S/c1-39(37,38)27-18-16-24(17-19-27)22-34-32(36)28(25-12-5-6-13-25)14-7-8-21-35-23-30(26-10-3-2-4-11-26)29-15-9-20-33-31(29)35/h2-5,9-12,15-20,23,25,28H,6-8,13-14,21-22H2,1H3,(H,34,36) |
| InChIKey | TYGGFMDRNCBDMP-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|