C15H18N4O2 — CID 115340348
3-[(E)-2-[3-(4-methylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]ethenyl]aniline (PubChem CID 115340348) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 3-[(E)-2-[3-(4-methylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]ethenyl]aniline.
| Compound Name | 3-[(E)-2-[3-(4-methylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 115340348 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3-[(E)-2-[3-(4-methylmorpholin-2-yl)-1,2,4-oxadiazol-5-yl]ethenyl]aniline |
| SMILES | CN1CCOC(c2noc(/C=C/c3cccc(N)c3)n2)C1 |
| InChI | InChI=1S/C15H18N4O2/c1-19-7-8-20-13(10-19)15-17-14(21-18-15)6-5-11-3-2-4-12(16)9-11/h2-6,9,13H,7-8,10,16H2,1H3/b6-5+ |
| InChIKey | YVDVGHWOIKWSQS-AATRIKPKSA-N |
| XLogP | 1.83 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|