C18H25NO2 — CID 115340459
(3,3,5-trimethylcyclohexyl) (E)-3-(3-aminophenyl)prop-2-enoate (PubChem CID 115340459) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is (3,3,5-trimethylcyclohexyl) (E)-3-(3-aminophenyl)prop-2-enoate.
| Compound Name | (3,3,5-trimethylcyclohexyl) (E)-3-(3-aminophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 115340459 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (3,3,5-trimethylcyclohexyl) (E)-3-(3-aminophenyl)prop-2-enoate |
| SMILES | CC1CC(OC(=O)/C=C/c2cccc(N)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C18H25NO2/c1-13-9-16(12-18(2,3)11-13)21-17(20)8-7-14-5-4-6-15(19)10-14/h4-8,10,13,16H,9,11-12,19H2,1-3H3/b8-7+ |
| InChIKey | IIUZZYTUZASNJM-BQYQJAHWSA-N |
| XLogP | 4.04 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|