C34H42FN5O — CID 11534138
2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-4-(2-fluorophenyl)-N-propan-2-yl-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrimidine-5-carboxamide (PubChem CID 11534138) has the molecular formula C34H42FN5O and a molecular weight of 555.74 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-4-(2-fluorophenyl)-N-propan-2-yl-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-4-(2-fluorophenyl)-N-propan-2-yl-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 11534138 |
| Molecular Formula | C34H42FN5O |
| Molecular Weight | 555.74 g/mol |
| Exact Mass | 555.34 |
| IUPAC Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-4-(2-fluorophenyl)-N-propan-2-yl-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrimidine-5-carboxamide |
| SMILES | CC(C)N(Cc1ccc(N2CCCC2)cc1)C(=O)c1cnc(N2CCC3CCCCC3C2)nc1-c1ccccc1F |
| InChI | InChI=1S/C34H42FN5O/c1-24(2)40(22-25-13-15-28(16-14-25)38-18-7-8-19-38)33(41)30-21-36-34(37-32(30)29-11-5-6-12-31(29)35)39-20-17-26-9-3-4-10-27(26)23-39/h5-6,11-16,21,24,26-27H,3-4,7-10,17-20,22-23H2,1-2H3 |
| InChIKey | QIOOYACJQGBIRJ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.74 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|