C16H14Br2N2O — CID 115342754
(E)-3-(4-aminophenyl)-N-(2,6-dibromo-4-methylphenyl)prop-2-enamide (PubChem CID 115342754) has the molecular formula C16H14Br2N2O and a molecular weight of 410.11 g/mol. Its IUPAC name is (E)-3-(4-aminophenyl)-N-(2,6-dibromo-4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(4-aminophenyl)-N-(2,6-dibromo-4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 115342754 |
| Molecular Formula | C16H14Br2N2O |
| Molecular Weight | 410.11 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | (E)-3-(4-aminophenyl)-N-(2,6-dibromo-4-methylphenyl)prop-2-enamide |
| SMILES | Cc1cc(Br)c(NC(=O)/C=C/c2ccc(N)cc2)c(Br)c1 |
| InChI | InChI=1S/C16H14Br2N2O/c1-10-8-13(17)16(14(18)9-10)20-15(21)7-4-11-2-5-12(19)6-3-11/h2-9H,19H2,1H3,(H,20,21)/b7-4+ |
| InChIKey | KAJSANXOXWWKOB-QPJJXVBHSA-N |
| XLogP | 4.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.11 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|