C15H12ClIN2O — CID 115343128
(E)-3-(4-aminophenyl)-N-(2-chloro-4-iodophenyl)prop-2-enamide (PubChem CID 115343128) has the molecular formula C15H12ClIN2O and a molecular weight of 398.63 g/mol. Its IUPAC name is (E)-3-(4-aminophenyl)-N-(2-chloro-4-iodophenyl)prop-2-enamide.
| Compound Name | (E)-3-(4-aminophenyl)-N-(2-chloro-4-iodophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 115343128 |
| Molecular Formula | C15H12ClIN2O |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | (E)-3-(4-aminophenyl)-N-(2-chloro-4-iodophenyl)prop-2-enamide |
| SMILES | Nc1ccc(/C=C/C(=O)Nc2ccc(I)cc2Cl)cc1 |
| InChI | InChI=1S/C15H12ClIN2O/c16-13-9-11(17)4-7-14(13)19-15(20)8-3-10-1-5-12(18)6-2-10/h1-9H,18H2,(H,19,20)/b8-3+ |
| InChIKey | JIJZDGAIWZTZKI-FPYGCLRLSA-N |
| XLogP | 4.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|