C13H16N2O4 — CID 115343495
2-[[(E)-3-(3-aminophenyl)prop-2-enoyl]amino]-3-hydroxybutanoic acid (PubChem CID 115343495) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-[[(E)-3-(3-aminophenyl)prop-2-enoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[(E)-3-(3-aminophenyl)prop-2-enoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 115343495 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-[[(E)-3-(3-aminophenyl)prop-2-enoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)/C=C/c1cccc(N)c1)C(=O)O |
| InChI | InChI=1S/C13H16N2O4/c1-8(16)12(13(18)19)15-11(17)6-5-9-3-2-4-10(14)7-9/h2-8,12,16H,14H2,1H3,(H,15,17)(H,18,19)/b6-5+ |
| InChIKey | JFDLBLGWCQDQJL-AATRIKPKSA-N |
| XLogP | 0.23 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|