C16H20N2O3 — CID 115344833
3-[1-[(E)-3-(4-aminophenyl)prop-2-enoyl]pyrrolidin-3-yl]propanoic acid (PubChem CID 115344833) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-[1-[(E)-3-(4-aminophenyl)prop-2-enoyl]pyrrolidin-3-yl]propanoic acid.
| Compound Name | 3-[1-[(E)-3-(4-aminophenyl)prop-2-enoyl]pyrrolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 115344833 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-[1-[(E)-3-(4-aminophenyl)prop-2-enoyl]pyrrolidin-3-yl]propanoic acid |
| SMILES | Nc1ccc(/C=C/C(=O)N2CCC(CCC(=O)O)C2)cc1 |
| InChI | InChI=1S/C16H20N2O3/c17-14-5-1-12(2-6-14)3-7-15(19)18-10-9-13(11-18)4-8-16(20)21/h1-3,5-7,13H,4,8-11,17H2,(H,20,21)/b7-3+ |
| InChIKey | QNKKQRLLEWNJOC-XVNBXDOJSA-N |
| XLogP | 2.00 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|