C14H16N2O4 — CID 115345080
2-[[(1R)-1-(furan-2-yl)ethyl]amino]-1-(4-nitrophenyl)ethanol (PubChem CID 115345080) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-[[(1R)-1-(furan-2-yl)ethyl]amino]-1-(4-nitrophenyl)ethanol.
| Compound Name | 2-[[(1R)-1-(furan-2-yl)ethyl]amino]-1-(4-nitrophenyl)ethanol |
|---|---|
| PubChem CID | 115345080 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-[[(1R)-1-(furan-2-yl)ethyl]amino]-1-(4-nitrophenyl)ethanol |
| SMILES | C[C@@H](NCC(O)c1ccc([N+](=O)[O-])cc1)c1ccco1 |
| InChI | InChI=1S/C14H16N2O4/c1-10(14-3-2-8-20-14)15-9-13(17)11-4-6-12(7-5-11)16(18)19/h2-8,10,13,15,17H,9H2,1H3/t10-,13?/m1/s1 |
| InChIKey | SBHXTSINCPBQTG-VUUHIHSGSA-N |
| XLogP | 2.57 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|