C23H16BrCl2F2N2O4P — CID 11534522
[[2-bromo-4-[(3,4-dichloro-N-(5-phenyl-1,3-oxazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 11534522) has the molecular formula C23H16BrCl2F2N2O4P and a molecular weight of 604.17 g/mol. Its IUPAC name is [[2-bromo-4-[(3,4-dichloro-N-(5-phenyl-1,3-oxazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[(3,4-dichloro-N-(5-phenyl-1,3-oxazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 11534522 |
| Molecular Formula | C23H16BrCl2F2N2O4P |
| Molecular Weight | 604.17 g/mol |
| Exact Mass | 601.94 |
| IUPAC Name | [[2-bromo-4-[(3,4-dichloro-N-(5-phenyl-1,3-oxazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)c1ccc(CN(c2ccc(Cl)c(Cl)c2)c2ncc(-c3ccccc3)o2)cc1Br |
| InChI | InChI=1S/C23H16BrCl2F2N2O4P/c24-18-10-14(6-8-17(18)23(27,28)35(31,32)33)13-30(16-7-9-19(25)20(26)11-16)22-29-12-21(34-22)15-4-2-1-3-5-15/h1-12H,13H2,(H2,31,32,33) |
| InChIKey | JBGRWTBKAICQAH-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.17 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|