C27H19Cl3N4O3S2 — CID 11534594
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[2,2-bis(4-chlorophenyl)ethyl]-4-chlorobenzamide (PubChem CID 11534594) has the molecular formula C27H19Cl3N4O3S2 and a molecular weight of 617.97 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[2,2-bis(4-chlorophenyl)ethyl]-4-chlorobenzamide.
| Compound Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[2,2-bis(4-chlorophenyl)ethyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 11534594 |
| Molecular Formula | C27H19Cl3N4O3S2 |
| Molecular Weight | 617.97 g/mol |
| Exact Mass | 616.00 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[2,2-bis(4-chlorophenyl)ethyl]-4-chlorobenzamide |
| SMILES | O=C(NCC(c1ccc(Cl)cc1)c1ccc(Cl)cc1)c1ccc(Cl)cc1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C27H19Cl3N4O3S2/c28-18-8-4-16(5-9-18)22(17-6-10-19(29)11-7-17)15-31-27(35)21-13-12-20(30)14-24(21)34-39(36,37)25-3-1-2-23-26(25)33-38-32-23/h1-14,22,34H,15H2,(H,31,35) |
| InChIKey | GFVLNOGBGOOLFJ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.97 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|