C15H24N4 — CID 115346080
4-(1-ethylindazol-3-yl)-1-N,1-N-dimethylbutane-1,3-diamine (PubChem CID 115346080) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-(1-ethylindazol-3-yl)-1-N,1-N-dimethylbutane-1,3-diamine.
| Compound Name | 4-(1-ethylindazol-3-yl)-1-N,1-N-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 115346080 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 4-(1-ethylindazol-3-yl)-1-N,1-N-dimethylbutane-1,3-diamine |
| SMILES | CCn1nc(CC(N)CCN(C)C)c2ccccc21 |
| InChI | InChI=1S/C15H24N4/c1-4-19-15-8-6-5-7-13(15)14(17-19)11-12(16)9-10-18(2)3/h5-8,12H,4,9-11,16H2,1-3H3 |
| InChIKey | VYXVCUQLAUEKMT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |