C34H66OSiSn — CID 11534697
tert-butyl-dimethyl-[(2E,4R,5R,6E,8E,11E)-3,5,7,11-tetramethyl-12-tributylstannyldodeca-2,6,8,11-tetraen-4-yl]oxysilane (PubChem CID 11534697) has the molecular formula C34H66OSiSn and a molecular weight of 637.70 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2E,4R,5R,6E,8E,11E)-3,5,7,11-tetramethyl-12-tributylstannyldodeca-2,6,8,11-tetraen-4-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2E,4R,5R,6E,8E,11E)-3,5,7,11-tetramethyl-12-tributylstannyldodeca-2,6,8,11-tetraen-4-yl]oxysilane |
|---|---|
| PubChem CID | 11534697 |
| Molecular Formula | C34H66OSiSn |
| Molecular Weight | 637.70 g/mol |
| Exact Mass | 638.39 |
| IUPAC Name | tert-butyl-dimethyl-[(2E,4R,5R,6E,8E,11E)-3,5,7,11-tetramethyl-12-tributylstannyldodeca-2,6,8,11-tetraen-4-yl]oxysilane |
| SMILES | C/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(C)/C=C/C/C(C)=C/[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C22H39OSi.3C4H9.Sn/c1-12-19(5)21(23-24(10,11)22(7,8)9)20(6)16-18(4)15-13-14-17(2)3;3*1-3-4-2;/h2,12-13,15-16,20-21H,14H2,1,3-11H3;3*1,3-4H2,2H3;/b15-13+,17-2?,18-16+,19-12+;;;;/t20-,21+;;;;/m1..../s1 |
| InChIKey | QAQHXMKKGQFVTR-GFSJKVPYSA-N |
| XLogP | 12.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.70 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|