C13H17NO2 — CID 115347611
1,3-dimethyl-5-[(Z)-3-methyl-2-nitrobut-1-enyl]benzene (PubChem CID 115347611) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(Z)-3-methyl-2-nitrobut-1-enyl]benzene.
| Compound Name | 1,3-dimethyl-5-[(Z)-3-methyl-2-nitrobut-1-enyl]benzene |
|---|---|
| PubChem CID | 115347611 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1,3-dimethyl-5-[(Z)-3-methyl-2-nitrobut-1-enyl]benzene |
| SMILES | Cc1cc(C)cc(/C=C(/C(C)C)[N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H17NO2/c1-9(2)13(14(15)16)8-12-6-10(3)5-11(4)7-12/h5-9H,1-4H3/b13-8- |
| InChIKey | RJXXAYFZNXROAD-JYRVWZFOSA-N |
| XLogP | 3.58 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|