C13H17ClN2O3 — CID 115352751
methyl 2-[2-chloro-5-(methylcarbamoyl)anilino]butanoate (PubChem CID 115352751) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is methyl 2-[2-chloro-5-(methylcarbamoyl)anilino]butanoate.
| Compound Name | methyl 2-[2-chloro-5-(methylcarbamoyl)anilino]butanoate |
|---|---|
| PubChem CID | 115352751 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | methyl 2-[2-chloro-5-(methylcarbamoyl)anilino]butanoate |
| SMILES | CCC(Nc1cc(C(=O)NC)ccc1Cl)C(=O)OC |
| InChI | InChI=1S/C13H17ClN2O3/c1-4-10(13(18)19-3)16-11-7-8(12(17)15-2)5-6-9(11)14/h5-7,10,16H,4H2,1-3H3,(H,15,17) |
| InChIKey | KLZYCRSMODAAEE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |