2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid

C10H15N3O4 — CID 115354708

IUPAC2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid
SMILESCCN(CC(=O)O)c1nc(OC)cc(OC)n1
InChIInChI=1S/C10H15N3O4/c1-4-13(6-9(14)15)10-11-7(16-2)5-8(12-10)17-3/h5H,4,6H2,1-3H3,(H,14,15)
InChIKeyJRKWIEOFKJQVSX-UHFFFAOYSA-N
MW241.25 g/mol
LogP0.40
Rot. Bonds6

About 2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid

2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid (PubChem CID 115354708) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid.

Molecular Properties

Compound Name2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid
PubChem CID115354708
Molecular FormulaC10H15N3O4
Molecular Weight241.25 g/mol
Exact Mass241.11
IUPAC Name2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid
SMILESCCN(CC(=O)O)c1nc(OC)cc(OC)n1
InChIInChI=1S/C10H15N3O4/c1-4-13(6-9(14)15)10-11-7(16-2)5-8(12-10)17-3/h5H,4,6H2,1-3H3,(H,14,15)
InChIKeyJRKWIEOFKJQVSX-UHFFFAOYSA-N
XLogP0.40
TPSA84.78 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.25
LogP ≤ 50.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid?
The IUPAC name of 2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid (CID 115354708) is 2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid.
What is the SMILES notation for 2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid?
The canonical SMILES for 2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid is CCN(CC(=O)O)c1nc(OC)cc(OC)n1.
What is the InChIKey of 2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid?
The InChIKey is JRKWIEOFKJQVSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O4/c1-4-13(6-9(14)15)10-11-7(16-2)5-8(12-10)17-3/h5H,4,6H2,1-3H3,(H,14,15).
What are the key properties of 2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid?
2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid has a molecular weight of 241.25 g/mol, XLogP of 0.40, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,6-dimethoxypyrimidin-2-yl)-ethylamino]acetic acid is sourced from PubChem (CID 115354708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).