About N'-cyclopropyl-N-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine
N'-cyclopropyl-N-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine (PubChem CID 115355111) has the molecular formula C12H20N4O2
and a molecular weight of 252.32 g/mol. Its IUPAC name is N'-cyclopropyl-N-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-cyclopropyl-N-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine |
| PubChem CID | 115355111 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N'-cyclopropyl-N-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine |
| SMILES | COc1cc(OC)nc(NCCN(C)C2CC2)n1 |
| InChI | InChI=1S/C12H20N4O2/c1-16(9-4-5-9)7-6-13-12-14-10(17-2)8-11(15-12)18-3/h8-9H,4-7H2,1-3H3,(H,13,14,15) |
| InChIKey | KKXSSXUNKDQBFK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N'-cyclopropyl-N-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopropyl-N-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine?
The IUPAC name of N'-cyclopropyl-N-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine (CID 115355111) is N'-cyclopropyl-N-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-cyclopropyl-N-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-cyclopropyl-N-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine is COc1cc(OC)nc(NCCN(C)C2CC2)n1.
What is the InChIKey of N'-cyclopropyl-N-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine?
The InChIKey is KKXSSXUNKDQBFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O2/c1-16(9-4-5-9)7-6-13-12-14-10(17-2)8-11(15-12)18-3/h8-9H,4-7H2,1-3H3,(H,13,14,15).
What are the key properties of N'-cyclopropyl-N-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine?
N'-cyclopropyl-N-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine has a molecular weight of 252.32 g/mol, XLogP of 1.00, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopropyl-N-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 115355111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).