C11H14N4O4 — CID 115355191
3-[(4,6-dimethoxypyrimidin-2-yl)amino]piperidine-2,6-dione (PubChem CID 115355191) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is 3-[(4,6-dimethoxypyrimidin-2-yl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(4,6-dimethoxypyrimidin-2-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 115355191 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 3-[(4,6-dimethoxypyrimidin-2-yl)amino]piperidine-2,6-dione |
| SMILES | COc1cc(OC)nc(NC2CCC(=O)NC2=O)n1 |
| InChI | InChI=1S/C11H14N4O4/c1-18-8-5-9(19-2)15-11(14-8)12-6-3-4-7(16)13-10(6)17/h5-6H,3-4H2,1-2H3,(H,12,14,15)(H,13,16,17) |
| InChIKey | RVWVFTIITLFLKT-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|