About N'-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine
N'-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine (PubChem CID 115355307) has the molecular formula C9H16N4O2
and a molecular weight of 212.25 g/mol. Its IUPAC name is N'-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine |
| PubChem CID | 115355307 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N'-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine |
| SMILES | COc1cc(OC)nc(N(C)CCN)n1 |
| InChI | InChI=1S/C9H16N4O2/c1-13(5-4-10)9-11-7(14-2)6-8(12-9)15-3/h6H,4-5,10H2,1-3H3 |
| InChIKey | FPKOKYRWANJXHW-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N'-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine?
The IUPAC name of N'-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine (CID 115355307) is N'-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine is COc1cc(OC)nc(N(C)CCN)n1.
What is the InChIKey of N'-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine?
The InChIKey is FPKOKYRWANJXHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O2/c1-13(5-4-10)9-11-7(14-2)6-8(12-9)15-3/h6H,4-5,10H2,1-3H3.
What are the key properties of N'-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine?
N'-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine has a molecular weight of 212.25 g/mol, XLogP of -0.11, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4,6-dimethoxypyrimidin-2-yl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 115355307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).