About (7aS)-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one
(7aS)-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (PubChem CID 11535557) has the molecular formula C6H7NO2
and a molecular weight of 125.13 g/mol. Its IUPAC name is (7aS)-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
Molecular Properties
| Compound Name | (7aS)-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| PubChem CID | 11535557 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | (7aS)-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| SMILES | O=C1OC[C@@H]2C=CCN12 |
| InChI | InChI=1S/C6H7NO2/c8-6-7-3-1-2-5(7)4-9-6/h1-2,5H,3-4H2/t5-/m0/s1 |
| InChIKey | BOEKBAFJZFGCRD-YFKPBYRVSA-N |
| XLogP | 0.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7aS)-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7aS)-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one?
The IUPAC name of (7aS)-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (CID 11535557) is (7aS)-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
What is the SMILES notation for (7aS)-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one?
The canonical SMILES for (7aS)-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one is O=C1OC[C@@H]2C=CCN12.
What is the InChIKey of (7aS)-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one?
The InChIKey is BOEKBAFJZFGCRD-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H7NO2/c8-6-7-3-1-2-5(7)4-9-6/h1-2,5H,3-4H2/t5-/m0/s1.
What are the key properties of (7aS)-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one?
(7aS)-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one has a molecular weight of 125.13 g/mol, XLogP of 0.38, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7aS)-5,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one is sourced from PubChem (CID 11535557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).