C12H23N3O — CID 115356567
N-tert-butyl-2-[(3-cyano-3-methylbutyl)amino]acetamide (PubChem CID 115356567) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is N-tert-butyl-2-[(3-cyano-3-methylbutyl)amino]acetamide.
| Compound Name | N-tert-butyl-2-[(3-cyano-3-methylbutyl)amino]acetamide |
|---|---|
| PubChem CID | 115356567 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | N-tert-butyl-2-[(3-cyano-3-methylbutyl)amino]acetamide |
| SMILES | CC(C)(C#N)CCNCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H23N3O/c1-11(2,3)15-10(16)8-14-7-6-12(4,5)9-13/h14H,6-8H2,1-5H3,(H,15,16) |
| InChIKey | GQZWQNKYSJYEDN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|