C11H16O2 — CID 11535671
methyl (1S,2S,3R,4R)-3-methylbicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 11535671) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is methyl (1S,2S,3R,4R)-3-methylbicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | methyl (1S,2S,3R,4R)-3-methylbicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11535671 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | methyl (1S,2S,3R,4R)-3-methylbicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C)[C@H]2C=C[C@@H]1CC2 |
| InChI | InChI=1S/C11H16O2/c1-7-8-3-5-9(6-4-8)10(7)11(12)13-2/h3,5,7-10H,4,6H2,1-2H3/t7-,8+,9-,10+/m1/s1 |
| InChIKey | UKAHEABPXIOPRI-RGOKHQFPSA-N |
| XLogP | 2.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|