C15H19BrClN3O — CID 115357062
2-[6-bromo-2-(1-chloroethyl)benzimidazol-1-yl]-N-tert-butylacetamide (PubChem CID 115357062) has the molecular formula C15H19BrClN3O and a molecular weight of 372.69 g/mol. Its IUPAC name is 2-[6-bromo-2-(1-chloroethyl)benzimidazol-1-yl]-N-tert-butylacetamide.
| Compound Name | 2-[6-bromo-2-(1-chloroethyl)benzimidazol-1-yl]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 115357062 |
| Molecular Formula | C15H19BrClN3O |
| Molecular Weight | 372.69 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 2-[6-bromo-2-(1-chloroethyl)benzimidazol-1-yl]-N-tert-butylacetamide |
| SMILES | CC(Cl)c1nc2ccc(Br)cc2n1CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H19BrClN3O/c1-9(17)14-18-11-6-5-10(16)7-12(11)20(14)8-13(21)19-15(2,3)4/h5-7,9H,8H2,1-4H3,(H,19,21) |
| InChIKey | HOHJQAFBQRWEJY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.69 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|