About N-tert-butyl-2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide
N-tert-butyl-2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide (PubChem CID 115357088) has the molecular formula C14H22ClN5O
and a molecular weight of 311.82 g/mol. Its IUPAC name is N-tert-butyl-2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide |
| PubChem CID | 115357088 |
| Molecular Formula | C14H22ClN5O |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N-tert-butyl-2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide |
| SMILES | Cc1nn(C)c2c1nc(C(C)Cl)n2CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H22ClN5O/c1-8(15)12-16-11-9(2)18-19(6)13(11)20(12)7-10(21)17-14(3,4)5/h8H,7H2,1-6H3,(H,17,21) |
| InChIKey | KGXXWKBWIKCQOO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide?
The IUPAC name of N-tert-butyl-2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide (CID 115357088) is N-tert-butyl-2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide.
What is the SMILES notation for N-tert-butyl-2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide?
The canonical SMILES for N-tert-butyl-2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide is Cc1nn(C)c2c1nc(C(C)Cl)n2CC(=O)NC(C)(C)C.
What is the InChIKey of N-tert-butyl-2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide?
The InChIKey is KGXXWKBWIKCQOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22ClN5O/c1-8(15)12-16-11-9(2)18-19(6)13(11)20(12)7-10(21)17-14(3,4)5/h8H,7H2,1-6H3,(H,17,21).
What are the key properties of N-tert-butyl-2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide?
N-tert-butyl-2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide has a molecular weight of 311.82 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-[5-(1-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]acetamide is sourced from PubChem (CID 115357088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).