C12H19N7O — CID 115357489
N-tert-butyl-2-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]acetamide (PubChem CID 115357489) has the molecular formula C12H19N7O and a molecular weight of 277.33 g/mol. Its IUPAC name is N-tert-butyl-2-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]acetamide.
| Compound Name | N-tert-butyl-2-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]acetamide |
|---|---|
| PubChem CID | 115357489 |
| Molecular Formula | C12H19N7O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N-tert-butyl-2-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]acetamide |
| SMILES | CC(C)(C)NC(=O)CNc1nc(NN)cn2ccnc12 |
| InChI | InChI=1S/C12H19N7O/c1-12(2,3)17-9(20)6-15-10-11-14-4-5-19(11)7-8(16-10)18-13/h4-5,7,18H,6,13H2,1-3H3,(H,15,16)(H,17,20) |
| InChIKey | JVTXXVQJWKUCAC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 109.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|