About (6R)-6-ethyl-6H-furo[3,4-g][1]benzofuran-8-one
(6R)-6-ethyl-6H-furo[3,4-g][1]benzofuran-8-one (PubChem CID 11535768) has the molecular formula C12H10O3
and a molecular weight of 202.21 g/mol. Its IUPAC name is (6R)-6-ethyl-6H-furo[3,4-g][1]benzofuran-8-one.
Molecular Properties
| Compound Name | (6R)-6-ethyl-6H-furo[3,4-g][1]benzofuran-8-one |
| PubChem CID | 11535768 |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | (6R)-6-ethyl-6H-furo[3,4-g][1]benzofuran-8-one |
| SMILES | CC[C@H]1OC(=O)c2c1ccc1ccoc21 |
| InChI | InChI=1S/C12H10O3/c1-2-9-8-4-3-7-5-6-14-11(7)10(8)12(13)15-9/h3-6,9H,2H2,1H3/t9-/m1/s1 |
| InChIKey | NPJOJMUVGGLVJT-SECBINFHSA-N |
| XLogP | 3.05 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6R)-6-ethyl-6H-furo[3,4-g][1]benzofuran-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-ethyl-6H-furo[3,4-g][1]benzofuran-8-one?
The IUPAC name of (6R)-6-ethyl-6H-furo[3,4-g][1]benzofuran-8-one (CID 11535768) is (6R)-6-ethyl-6H-furo[3,4-g][1]benzofuran-8-one.
What is the SMILES notation for (6R)-6-ethyl-6H-furo[3,4-g][1]benzofuran-8-one?
The canonical SMILES for (6R)-6-ethyl-6H-furo[3,4-g][1]benzofuran-8-one is CC[C@H]1OC(=O)c2c1ccc1ccoc21.
What is the InChIKey of (6R)-6-ethyl-6H-furo[3,4-g][1]benzofuran-8-one?
The InChIKey is NPJOJMUVGGLVJT-SECBINFHSA-N. The full InChI is InChI=1S/C12H10O3/c1-2-9-8-4-3-7-5-6-14-11(7)10(8)12(13)15-9/h3-6,9H,2H2,1H3/t9-/m1/s1.
What are the key properties of (6R)-6-ethyl-6H-furo[3,4-g][1]benzofuran-8-one?
(6R)-6-ethyl-6H-furo[3,4-g][1]benzofuran-8-one has a molecular weight of 202.21 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-ethyl-6H-furo[3,4-g][1]benzofuran-8-one is sourced from PubChem (CID 11535768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).