C14H18N2O2S — CID 115357836
5-amino-N-(3-hydroxy-2,2-dimethylpropyl)-1-benzothiophene-2-carboxamide (PubChem CID 115357836) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 5-amino-N-(3-hydroxy-2,2-dimethylpropyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-amino-N-(3-hydroxy-2,2-dimethylpropyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 115357836 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 5-amino-N-(3-hydroxy-2,2-dimethylpropyl)-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)(CO)CNC(=O)c1cc2cc(N)ccc2s1 |
| InChI | InChI=1S/C14H18N2O2S/c1-14(2,8-17)7-16-13(18)12-6-9-5-10(15)3-4-11(9)19-12/h3-6,17H,7-8,15H2,1-2H3,(H,16,18) |
| InChIKey | QBKNYCBHKORREM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|