About 7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene
7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene (PubChem CID 11535833) has the molecular formula C12H14F2O
and a molecular weight of 212.24 g/mol. Its IUPAC name is 7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene |
| PubChem CID | 11535833 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene |
| SMILES | CCCC1CCc2ccc(F)c(F)c2O1 |
| InChI | InChI=1S/C12H14F2O/c1-2-3-9-6-4-8-5-7-10(13)11(14)12(8)15-9/h5,7,9H,2-4,6H2,1H3 |
| InChIKey | AGFCDCQVBLOBNV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene?
The IUPAC name of 7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene (CID 11535833) is 7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene.
What is the SMILES notation for 7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene?
The canonical SMILES for 7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene is CCCC1CCc2ccc(F)c(F)c2O1.
What is the InChIKey of 7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene?
The InChIKey is AGFCDCQVBLOBNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2O/c1-2-3-9-6-4-8-5-7-10(13)11(14)12(8)15-9/h5,7,9H,2-4,6H2,1H3.
What are the key properties of 7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene?
7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene has a molecular weight of 212.24 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene is sourced from PubChem (CID 11535833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).