About 1-(1-adamantyl)-2,2-difluoroethanone
1-(1-adamantyl)-2,2-difluoroethanone (PubChem CID 11535851) has the molecular formula C12H16F2O
and a molecular weight of 214.25 g/mol. Its IUPAC name is 1-(1-adamantyl)-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-2,2-difluoroethanone |
| PubChem CID | 11535851 |
| Molecular Formula | C12H16F2O |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-(1-adamantyl)-2,2-difluoroethanone |
| SMILES | O=C(C(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C12H16F2O/c13-11(14)10(15)12-4-7-1-8(5-12)3-9(2-7)6-12/h7-9,11H,1-6H2 |
| InChIKey | FBPVRJTWPBIDPE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(1-adamantyl)-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-2,2-difluoroethanone?
The IUPAC name of 1-(1-adamantyl)-2,2-difluoroethanone (CID 11535851) is 1-(1-adamantyl)-2,2-difluoroethanone.
What is the SMILES notation for 1-(1-adamantyl)-2,2-difluoroethanone?
The canonical SMILES for 1-(1-adamantyl)-2,2-difluoroethanone is O=C(C(F)F)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(1-adamantyl)-2,2-difluoroethanone?
The InChIKey is FBPVRJTWPBIDPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2O/c13-11(14)10(15)12-4-7-1-8(5-12)3-9(2-7)6-12/h7-9,11H,1-6H2.
What are the key properties of 1-(1-adamantyl)-2,2-difluoroethanone?
1-(1-adamantyl)-2,2-difluoroethanone has a molecular weight of 214.25 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-2,2-difluoroethanone is sourced from PubChem (CID 11535851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).