C15H22FNO2 — CID 115358531
5-fluoro-2-[1-[[1-(hydroxymethyl)cyclopentyl]methylamino]ethyl]phenol (PubChem CID 115358531) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 5-fluoro-2-[1-[[1-(hydroxymethyl)cyclopentyl]methylamino]ethyl]phenol.
| Compound Name | 5-fluoro-2-[1-[[1-(hydroxymethyl)cyclopentyl]methylamino]ethyl]phenol |
|---|---|
| PubChem CID | 115358531 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 5-fluoro-2-[1-[[1-(hydroxymethyl)cyclopentyl]methylamino]ethyl]phenol |
| SMILES | CC(NCC1(CO)CCCC1)c1ccc(F)cc1O |
| InChI | InChI=1S/C15H22FNO2/c1-11(13-5-4-12(16)8-14(13)19)17-9-15(10-18)6-2-3-7-15/h4-5,8,11,17-19H,2-3,6-7,9-10H2,1H3 |
| InChIKey | GEQZNSZUUFUXML-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|