C12H25NO2 — CID 115358645
[1-[(1-methoxybutan-2-ylamino)methyl]cyclopentyl]methanol (PubChem CID 115358645) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is [1-[(1-methoxybutan-2-ylamino)methyl]cyclopentyl]methanol.
| Compound Name | [1-[(1-methoxybutan-2-ylamino)methyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 115358645 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | [1-[(1-methoxybutan-2-ylamino)methyl]cyclopentyl]methanol |
| SMILES | CCC(COC)NCC1(CO)CCCC1 |
| InChI | InChI=1S/C12H25NO2/c1-3-11(8-15-2)13-9-12(10-14)6-4-5-7-12/h11,13-14H,3-10H2,1-2H3 |
| InChIKey | GLGBCQPIPRITRG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |