C11H13N3O2 — CID 11535880
1-methylspiro[6,7-dihydro-5H-indole-4,5'-imidazolidine]-2',4'-dione (PubChem CID 11535880) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-methylspiro[6,7-dihydro-5H-indole-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 1-methylspiro[6,7-dihydro-5H-indole-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 11535880 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1-methylspiro[6,7-dihydro-5H-indole-4,5'-imidazolidine]-2',4'-dione |
| SMILES | Cn1ccc2c1CCCC21NC(=O)NC1=O |
| InChI | InChI=1S/C11H13N3O2/c1-14-6-4-7-8(14)3-2-5-11(7)9(15)12-10(16)13-11/h4,6H,2-3,5H2,1H3,(H2,12,13,15,16) |
| InChIKey | ICJNMTOEHPCHBQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|