C23H30N2O — CID 1153590
2,2-diphenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide (PubChem CID 1153590) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is 2,2-diphenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide.
| Compound Name | 2,2-diphenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 1153590 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 2,2-diphenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
| SMILES | CC1(C)CC(NC(=O)C(c2ccccc2)c2ccccc2)CC(C)(C)N1 |
| InChI | InChI=1S/C23H30N2O/c1-22(2)15-19(16-23(3,4)25-22)24-21(26)20(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19-20,25H,15-16H2,1-4H3,(H,24,26) |
| InChIKey | DPSWRDGIRFHGNJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |